C16H20N5O13P3 — CID 102003092
[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] [hydroxy(phenoxy)phosphoryl] hydrogen phosphate (PubChem CID 102003092) has the molecular formula C16H20N5O13P3 and a molecular weight of 583.28 g/mol. Its IUPAC name is [[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] [hydroxy(phenoxy)phosphoryl] hydrogen phosphate.
| Compound Name | [[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] [hydroxy(phenoxy)phosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 102003092 |
| Molecular Formula | C16H20N5O13P3 |
| Molecular Weight | 583.28 g/mol |
| Exact Mass | 583.03 |
| IUPAC Name | [[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] [hydroxy(phenoxy)phosphoryl] hydrogen phosphate |
| SMILES | Cc1cn([C@H]2C[C@H](N=[N+]=[N-])[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)Oc3ccccc3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H20N5O13P3/c1-10-8-21(16(23)18-15(10)22)14-7-12(19-20-17)13(31-14)9-30-35(24,25)33-37(28,29)34-36(26,27)32-11-5-3-2-4-6-11/h2-6,8,12-14H,7,9H2,1H3,(H,24,25)(H,26,27)(H,28,29)(H,18,22,23)/t12-,13+,14+/m0/s1 |
| InChIKey | LCIKOXLWDRTORT-BFHYXJOUSA-N |
| XLogP | 2.24 |
| TPSA | 261.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.28 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|