C16H19N6O7P — CID 45268856
[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl (2-methyl-3-pyridinyl) hydrogen phosphate (PubChem CID 45268856) has the molecular formula C16H19N6O7P and a molecular weight of 438.34 g/mol. Its IUPAC name is [(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl (2-methyl-3-pyridinyl) hydrogen phosphate.
| Compound Name | [(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl (2-methyl-3-pyridinyl) hydrogen phosphate |
|---|---|
| PubChem CID | 45268856 |
| Molecular Formula | C16H19N6O7P |
| Molecular Weight | 438.34 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | [(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl (2-methyl-3-pyridinyl) hydrogen phosphate |
| SMILES | Cc1ncccc1OP(=O)(O)OC[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)C[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C16H19N6O7P/c1-9-7-22(16(24)19-15(9)23)14-6-11(20-21-17)13(28-14)8-27-30(25,26)29-12-4-3-5-18-10(12)2/h3-5,7,11,13-14H,6,8H2,1-2H3,(H,25,26)(H,19,23,24)/t11-,13+,14+/m0/s1 |
| InChIKey | GFUBGRHDHWZART-IACUBPJLSA-N |
| XLogP | 1.71 |
| TPSA | 181.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|