C14H20N5O8PS — CID 10321469
S-ethyl 2-[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxyethanethioate (PubChem CID 10321469) has the molecular formula C14H20N5O8PS and a molecular weight of 449.38 g/mol. Its IUPAC name is S-ethyl 2-[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxyethanethioate.
| Compound Name | S-ethyl 2-[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxyethanethioate |
|---|---|
| PubChem CID | 10321469 |
| Molecular Formula | C14H20N5O8PS |
| Molecular Weight | 449.38 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | S-ethyl 2-[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxyethanethioate |
| SMILES | CCSC(=O)COP(=O)(O)OC[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)C[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C14H20N5O8PS/c1-3-29-12(20)7-26-28(23,24)25-6-10-9(17-18-15)4-11(27-10)19-5-8(2)13(21)16-14(19)22/h5,9-11H,3-4,6-7H2,1-2H3,(H,23,24)(H,16,21,22)/t9-,10+,11+/m0/s1 |
| InChIKey | CUSQBXUOOIJLRW-HBNTYKKESA-N |
| XLogP | 1.22 |
| TPSA | 185.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.38 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|