C26H32N10O10 — CID 175047875
bis[[3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl] hexanedioate (PubChem CID 175047875) has the molecular formula C26H32N10O10 and a molecular weight of 644.60 g/mol. Its IUPAC name is bis[[3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl] hexanedioate.
| Compound Name | bis[[3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl] hexanedioate |
|---|---|
| PubChem CID | 175047875 |
| Molecular Formula | C26H32N10O10 |
| Molecular Weight | 644.60 g/mol |
| Exact Mass | 644.23 |
| IUPAC Name | bis[[3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl] hexanedioate |
| SMILES | Cc1cn(C2CC(N=[N+]=[N-])C(COC(=O)CCCCC(=O)OCC3OC(n4cc(C)c(=O)[nH]c4=O)CC3N=[N+]=[N-])O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C26H32N10O10/c1-13-9-35(25(41)29-23(13)39)19-7-15(31-33-27)17(45-19)11-43-21(37)5-3-4-6-22(38)44-12-18-16(32-34-28)8-20(46-18)36-10-14(2)24(40)30-26(36)42/h9-10,15-20H,3-8,11-12H2,1-2H3,(H,29,39,41)(H,30,40,42) |
| InChIKey | JTKHZIPMACCFHB-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 278.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.60 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|