C16H21N5O7 — CID 161415417
5-[[3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]-3-methyl-5-oxopentanoic acid (PubChem CID 161415417) has the molecular formula C16H21N5O7 and a molecular weight of 395.37 g/mol. Its IUPAC name is 5-[[3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]-3-methyl-5-oxopentanoic acid.
| Compound Name | 5-[[3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]-3-methyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 161415417 |
| Molecular Formula | C16H21N5O7 |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 5-[[3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]-3-methyl-5-oxopentanoic acid |
| SMILES | Cc1cn(C2CC(N=[N+]=[N-])C(COC(=O)CC(C)CC(=O)O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H21N5O7/c1-8(3-13(22)23)4-14(24)27-7-11-10(19-20-17)5-12(28-11)21-6-9(2)15(25)18-16(21)26/h6,8,10-12H,3-5,7H2,1-2H3,(H,22,23)(H,18,25,26) |
| InChIKey | VWAFPEQZMPGILC-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 176.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|