C18H26N6O6 — CID 58777178
[(2S,3R,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 4-(butylamino)-4-oxobutanoate (PubChem CID 58777178) has the molecular formula C18H26N6O6 and a molecular weight of 422.44 g/mol. Its IUPAC name is [(2S,3R,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 4-(butylamino)-4-oxobutanoate.
| Compound Name | [(2S,3R,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 4-(butylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 58777178 |
| Molecular Formula | C18H26N6O6 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | [(2S,3R,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 4-(butylamino)-4-oxobutanoate |
| SMILES | CCCCNC(=O)CCC(=O)OC[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)C[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C18H26N6O6/c1-3-4-7-20-14(25)5-6-16(26)29-10-13-12(22-23-19)8-15(30-13)24-9-11(2)17(27)21-18(24)28/h9,12-13,15H,3-8,10H2,1-2H3,(H,20,25)(H,21,27,28)/t12-,13-,15-/m1/s1 |
| InChIKey | HLYIJDJNRIIWBN-UMVBOHGHSA-N |
| XLogP | 1.05 |
| TPSA | 168.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|