C20H27N5O12 — CID 10256414
1-O-[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl] 4-O-[[(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl] butanedioate (PubChem CID 10256414) has the molecular formula C20H27N5O12 and a molecular weight of 529.46 g/mol. Its IUPAC name is 1-O-[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl] 4-O-[[(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl] butanedioate.
| Compound Name | 1-O-[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl] 4-O-[[(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl] butanedioate |
|---|---|
| PubChem CID | 10256414 |
| Molecular Formula | C20H27N5O12 |
| Molecular Weight | 529.46 g/mol |
| Exact Mass | 529.17 |
| IUPAC Name | 1-O-[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl] 4-O-[[(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl] butanedioate |
| SMILES | Cc1cn([C@H]2C[C@H](N=[N+]=[N-])[C@@H](COC(=O)CCC(=O)OC[C@H]3O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]3O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H27N5O12/c1-8-5-25(20(33)22-18(8)31)12-4-9(23-24-21)10(36-12)6-34-13(26)2-3-14(27)35-7-11-15(28)16(29)17(30)19(32)37-11/h5,9-12,15-17,19,28-30,32H,2-4,6-7H2,1H3,(H,22,31,33)/t9-,10+,11+,12+,15+,16-,17+,19+/m0/s1 |
| InChIKey | VMIYZHQVDYSJCO-VBLWOKDSSA-N |
| XLogP | -2.52 |
| TPSA | 255.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.46 |
| LogP ≤ 5 | -2.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|