C14H17N5O6 — CID 10712893
[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl prop-2-enyl carbonate (PubChem CID 10712893) has the molecular formula C14H17N5O6 and a molecular weight of 351.32 g/mol. Its IUPAC name is [(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl prop-2-enyl carbonate.
| Compound Name | [(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl prop-2-enyl carbonate |
|---|---|
| PubChem CID | 10712893 |
| Molecular Formula | C14H17N5O6 |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | [(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl prop-2-enyl carbonate |
| SMILES | C=CCOC(=O)OC[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)C[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C14H17N5O6/c1-3-4-23-14(22)24-7-10-9(17-18-15)5-11(25-10)19-6-8(2)12(20)16-13(19)21/h3,6,9-11H,1,4-5,7H2,2H3,(H,16,20,21)/t9-,10+,11+/m0/s1 |
| InChIKey | CTDFECQCAXJARN-HBNTYKKESA-N |
| XLogP | 1.15 |
| TPSA | 148.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|