C17H20N6O5 — CID 21141194
[(2S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 1-methyl-2H-pyridine-3-carboxylate (PubChem CID 21141194) has the molecular formula C17H20N6O5 and a molecular weight of 388.38 g/mol. Its IUPAC name is [(2S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 1-methyl-2H-pyridine-3-carboxylate.
| Compound Name | [(2S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 1-methyl-2H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 21141194 |
| Molecular Formula | C17H20N6O5 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | [(2S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 1-methyl-2H-pyridine-3-carboxylate |
| SMILES | Cc1cn([C@H]2CC(N=[N+]=[N-])[C@@H](COC(=O)C3=CC=CN(C)C3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H20N6O5/c1-10-7-23(17(26)19-15(10)24)14-6-12(20-21-18)13(28-14)9-27-16(25)11-4-3-5-22(2)8-11/h3-5,7,12-14H,6,8-9H2,1-2H3,(H,19,24,26)/t12?,13-,14-/m1/s1 |
| InChIKey | HTZSHXKLDYGWEG-ILMHWDKJSA-N |
| XLogP | 0.74 |
| TPSA | 142.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|