C15H19N5O7 — CID 10981802
[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl [(Z)-4-hydroxybut-2-enyl] carbonate (PubChem CID 10981802) has the molecular formula C15H19N5O7 and a molecular weight of 381.35 g/mol. Its IUPAC name is [(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl [(Z)-4-hydroxybut-2-enyl] carbonate.
| Compound Name | [(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl [(Z)-4-hydroxybut-2-enyl] carbonate |
|---|---|
| PubChem CID | 10981802 |
| Molecular Formula | C15H19N5O7 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | [(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl [(Z)-4-hydroxybut-2-enyl] carbonate |
| SMILES | Cc1cn([C@H]2C[C@H](N=[N+]=[N-])[C@@H](COC(=O)OC/C=C\CO)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H19N5O7/c1-9-7-20(14(23)17-13(9)22)12-6-10(18-19-16)11(27-12)8-26-15(24)25-5-3-2-4-21/h2-3,7,10-12,21H,4-6,8H2,1H3,(H,17,22,23)/b3-2-/t10-,11+,12+/m0/s1 |
| InChIKey | HOZQLNWATRZWAQ-YFXGRDGWSA-N |
| XLogP | 0.51 |
| TPSA | 168.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|