C10H13As4N5O10 — CID 53239239
1-[(2R,4S,5S)-4-azido-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione;2,4,6,8,9,10-hexaoxa-1,3,5,7-tetrarsatricyclo[3.3.1.13,7]decane (PubChem CID 53239239) has the molecular formula C10H13As4N5O10 and a molecular weight of 662.93 g/mol. Its IUPAC name is 1-[(2R,4S,5S)-4-azido-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione;2,4,6,8,9,10-hexaoxa-1,3,5,7-tetrarsatricyclo[3.3.1.13,7]decane.
| Compound Name | 1-[(2R,4S,5S)-4-azido-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione;2,4,6,8,9,10-hexaoxa-1,3,5,7-tetrarsatricyclo[3.3.1.13,7]decane |
|---|---|
| PubChem CID | 53239239 |
| Molecular Formula | C10H13As4N5O10 |
| Molecular Weight | 662.93 g/mol |
| Exact Mass | 662.75 |
| IUPAC Name | 1-[(2R,4S,5S)-4-azido-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione;2,4,6,8,9,10-hexaoxa-1,3,5,7-tetrarsatricyclo[3.3.1.13,7]decane |
| SMILES | Cc1cn([C@H]2C[C@H](N=[N+]=[N-])[C@@H](CO)O2)c(=O)[nH]c1=O.O1[As]2O[As]3O[As]1O[As](O2)O3 |
| InChI | InChI=1S/C10H13N5O4.As4O6/c1-5-3-15(10(18)12-9(5)17)8-2-6(13-14-11)7(4-16)19-8;5-1-6-3-8-2(5)9-4(7-1)10-3/h3,6-8,16H,2,4H2,1H3,(H,12,17,18);/t6-,7+,8+;/m0./s1 |
| InChIKey | RZWAXHBNVSNSGI-HNPMAXIBSA-N |
| XLogP | -2.13 |
| TPSA | 188.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.93 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|