C9H10N8O4 — CID 10424498
5-azido-1-[(2R,4S,5S)-4-azido-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 10424498) has the molecular formula C9H10N8O4 and a molecular weight of 294.23 g/mol. Its IUPAC name is 5-azido-1-[(2R,4S,5S)-4-azido-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-azido-1-[(2R,4S,5S)-4-azido-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10424498 |
| Molecular Formula | C9H10N8O4 |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 5-azido-1-[(2R,4S,5S)-4-azido-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | [N-]=[N+]=Nc1cn([C@H]2C[C@H](N=[N+]=[N-])[C@@H](CO)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H10N8O4/c10-15-13-4-1-7(21-6(4)3-18)17-2-5(14-16-11)8(19)12-9(17)20/h2,4,6-7,18H,1,3H2,(H,12,19,20)/t4-,6+,7+/m0/s1 |
| InChIKey | ZQDKNJPMIORZGX-UBKIQSJTSA-N |
| XLogP | 0.44 |
| TPSA | 181.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|