C15H23N5O4 — CID 11724619
1-[(2S,4S,5S)-4-azido-5-(hydroxymethyl)oxolan-2-yl]-5-hexylpyrimidine-2,4-dione (PubChem CID 11724619) has the molecular formula C15H23N5O4 and a molecular weight of 337.38 g/mol. Its IUPAC name is 1-[(2S,4S,5S)-4-azido-5-(hydroxymethyl)oxolan-2-yl]-5-hexylpyrimidine-2,4-dione.
| Compound Name | 1-[(2S,4S,5S)-4-azido-5-(hydroxymethyl)oxolan-2-yl]-5-hexylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11724619 |
| Molecular Formula | C15H23N5O4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 1-[(2S,4S,5S)-4-azido-5-(hydroxymethyl)oxolan-2-yl]-5-hexylpyrimidine-2,4-dione |
| SMILES | CCCCCCc1cn([C@@H]2C[C@H](N=[N+]=[N-])[C@@H](CO)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H23N5O4/c1-2-3-4-5-6-10-8-20(15(23)17-14(10)22)13-7-11(18-19-16)12(9-21)24-13/h8,11-13,21H,2-7,9H2,1H3,(H,17,22,23)/t11-,12+,13-/m0/s1 |
| InChIKey | UUWXBZDKPJYRAP-XQQFMLRXSA-N |
| XLogP | 1.62 |
| TPSA | 133.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|