C14H21FN2O5 — CID 44568894
5-(5-fluoropentyl)-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 44568894) has the molecular formula C14H21FN2O5 and a molecular weight of 316.33 g/mol. Its IUPAC name is 5-(5-fluoropentyl)-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-(5-fluoropentyl)-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 44568894 |
| Molecular Formula | C14H21FN2O5 |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 5-(5-fluoropentyl)-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n([C@H]2C[C@H](O)[C@@H](CO)O2)cc1CCCCCF |
| InChI | InChI=1S/C14H21FN2O5/c15-5-3-1-2-4-9-7-17(14(21)16-13(9)20)12-6-10(19)11(8-18)22-12/h7,10-12,18-19H,1-6,8H2,(H,16,20,21)/t10-,11+,12+/m0/s1 |
| InChIKey | SJGXIZJRNOMSAZ-QJPTWQEYSA-N |
| XLogP | -0.14 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|