C14H20BrN3O6 — CID 57153361
2-bromo-N-[3-[1-[(2S,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]propyl]acetamide (PubChem CID 57153361) has the molecular formula C14H20BrN3O6 and a molecular weight of 406.23 g/mol. Its IUPAC name is 2-bromo-N-[3-[1-[(2S,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]propyl]acetamide.
| Compound Name | 2-bromo-N-[3-[1-[(2S,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]propyl]acetamide |
|---|---|
| PubChem CID | 57153361 |
| Molecular Formula | C14H20BrN3O6 |
| Molecular Weight | 406.23 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | 2-bromo-N-[3-[1-[(2S,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]propyl]acetamide |
| SMILES | O=C(CBr)NCCCc1cn([C@@H]2CC(O)[C@H](CO)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H20BrN3O6/c15-5-11(21)16-3-1-2-8-6-18(14(23)17-13(8)22)12-4-9(20)10(7-19)24-12/h6,9-10,12,19-20H,1-5,7H2,(H,16,21)(H,17,22,23)/t9?,10-,12-/m0/s1 |
| InChIKey | WTOINGDFSBIJAZ-CIZBPJNJSA-N |
| XLogP | -1.38 |
| TPSA | 133.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.23 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|