C17H28N2O5S2 — CID 175676660
5-[4-(tert-butyldisulfanyl)butyl]-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 175676660) has the molecular formula C17H28N2O5S2 and a molecular weight of 404.55 g/mol. Its IUPAC name is 5-[4-(tert-butyldisulfanyl)butyl]-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-[4-(tert-butyldisulfanyl)butyl]-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 175676660 |
| Molecular Formula | C17H28N2O5S2 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 5-[4-(tert-butyldisulfanyl)butyl]-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CC(C)(C)SSCCCCc1cn([C@H]2C[C@H](O)[C@@H](CO)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H28N2O5S2/c1-17(2,3)26-25-7-5-4-6-11-9-19(16(23)18-15(11)22)14-8-12(21)13(10-20)24-14/h9,12-14,20-21H,4-8,10H2,1-3H3,(H,18,22,23)/t12-,13+,14+/m0/s1 |
| InChIKey | MLSWVUSWFXQNIL-BFHYXJOUSA-N |
| XLogP | 1.68 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|