C11H14N6O4 — CID 21145602
N-[[(2R,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl]formamide (PubChem CID 21145602) has the molecular formula C11H14N6O4 and a molecular weight of 294.27 g/mol. Its IUPAC name is N-[[(2R,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl]formamide.
| Compound Name | N-[[(2R,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl]formamide |
|---|---|
| PubChem CID | 21145602 |
| Molecular Formula | C11H14N6O4 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | N-[[(2R,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl]formamide |
| SMILES | Cc1cn([C@H]2CC(N=[N+]=[N-])[C@@H](CNC=O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H14N6O4/c1-6-4-17(11(20)14-10(6)19)9-2-7(15-16-12)8(21-9)3-13-5-18/h4-5,7-9H,2-3H2,1H3,(H,13,18)(H,14,19,20)/t7?,8-,9-/m1/s1 |
| InChIKey | OQEOOZKGFMZYBW-CFCGPWAMSA-N |
| XLogP | -0.44 |
| TPSA | 141.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|