C19H23N5O3Se — CID 118735692
1-[(2R,4S,5S)-4-azido-5-[(2,4,6-trimethylphenyl)selanylmethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 118735692) has the molecular formula C19H23N5O3Se and a molecular weight of 448.39 g/mol. Its IUPAC name is 1-[(2R,4S,5S)-4-azido-5-[(2,4,6-trimethylphenyl)selanylmethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5S)-4-azido-5-[(2,4,6-trimethylphenyl)selanylmethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 118735692 |
| Molecular Formula | C19H23N5O3Se |
| Molecular Weight | 448.39 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | 1-[(2R,4S,5S)-4-azido-5-[(2,4,6-trimethylphenyl)selanylmethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cc(C)c([Se]C[C@H]2O[C@@H](n3cc(C)c(=O)[nH]c3=O)C[C@@H]2N=[N+]=[N-])c(C)c1 |
| InChI | InChI=1S/C19H23N5O3Se/c1-10-5-11(2)17(12(3)6-10)28-9-15-14(22-23-20)7-16(27-15)24-8-13(4)18(25)21-19(24)26/h5-6,8,14-16H,7,9H2,1-4H3,(H,21,25,26)/t14-,15+,16+/m0/s1 |
| InChIKey | KMTGGTJSPSSVQK-ARFHVFGLSA-N |
| XLogP | 2.18 |
| TPSA | 112.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.39 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|