C17H19N5O6S — CID 58981346
[(2S,3R,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 58981346) has the molecular formula C17H19N5O6S and a molecular weight of 421.44 g/mol. Its IUPAC name is [(2S,3R,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2S,3R,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 58981346 |
| Molecular Formula | C17H19N5O6S |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | [(2S,3R,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2O[C@@H](n3cc(C)c(=O)[nH]c3=O)C[C@H]2N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C17H19N5O6S/c1-10-3-5-12(6-4-10)29(25,26)27-9-14-13(20-21-18)7-15(28-14)22-8-11(2)16(23)19-17(22)24/h3-6,8,13-15H,7,9H2,1-2H3,(H,19,23,24)/t13-,14-,15-/m1/s1 |
| InChIKey | ITXJTDPGOIIPBF-RBSFLKMASA-N |
| XLogP | 1.53 |
| TPSA | 156.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|