C28H33N10O11P — CID 10676339
bis[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl] [hydroxy-(4-methylphenyl)methyl] phosphate (PubChem CID 10676339) has the molecular formula C28H33N10O11P and a molecular weight of 716.60 g/mol. Its IUPAC name is bis[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl] [hydroxy-(4-methylphenyl)methyl] phosphate.
| Compound Name | bis[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl] [hydroxy-(4-methylphenyl)methyl] phosphate |
|---|---|
| PubChem CID | 10676339 |
| Molecular Formula | C28H33N10O11P |
| Molecular Weight | 716.60 g/mol |
| Exact Mass | 716.21 |
| IUPAC Name | bis[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl] [hydroxy-(4-methylphenyl)methyl] phosphate |
| SMILES | Cc1ccc(C(O)OP(=O)(OC[C@H]2O[C@@H](n3cc(C)c(=O)[nH]c3=O)C[C@@H]2N=[N+]=[N-])OC[C@H]2O[C@@H](n3cc(C)c(=O)[nH]c3=O)C[C@@H]2N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C28H33N10O11P/c1-14-4-6-17(7-5-14)26(41)49-50(44,45-12-20-18(33-35-29)8-22(47-20)37-10-15(2)24(39)31-27(37)42)46-13-21-19(34-36-30)9-23(48-21)38-11-16(3)25(40)32-28(38)43/h4-7,10-11,18-23,26,41H,8-9,12-13H2,1-3H3,(H,31,39,42)(H,32,40,43)/t18-,19-,20+,21+,22+,23+,26?/m0/s1 |
| InChIKey | MBQFBCXZLGRUFL-FRTZAEHASA-N |
| XLogP | 2.79 |
| TPSA | 290.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.60 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|