C28H30N11O11P — CID 10556872
bis[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl] [(4-cyanophenyl)-hydroxymethyl] phosphate (PubChem CID 10556872) has the molecular formula C28H30N11O11P and a molecular weight of 727.59 g/mol. Its IUPAC name is bis[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl] [(4-cyanophenyl)-hydroxymethyl] phosphate.
| Compound Name | bis[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl] [(4-cyanophenyl)-hydroxymethyl] phosphate |
|---|---|
| PubChem CID | 10556872 |
| Molecular Formula | C28H30N11O11P |
| Molecular Weight | 727.59 g/mol |
| Exact Mass | 727.19 |
| IUPAC Name | bis[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl] [(4-cyanophenyl)-hydroxymethyl] phosphate |
| SMILES | Cc1cn([C@H]2C[C@H](N=[N+]=[N-])[C@@H](COP(=O)(OC[C@H]3O[C@@H](n4cc(C)c(=O)[nH]c4=O)C[C@@H]3N=[N+]=[N-])OC(O)c3ccc(C#N)cc3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C28H30N11O11P/c1-14-10-38(27(43)32-24(14)40)22-7-18(34-36-30)20(48-22)12-46-51(45,50-26(42)17-5-3-16(9-29)4-6-17)47-13-21-19(35-37-31)8-23(49-21)39-11-15(2)25(41)33-28(39)44/h3-6,10-11,18-23,26,42H,7-8,12-13H2,1-2H3,(H,32,40,43)(H,33,41,44)/t18-,19-,20+,21+,22+,23+,26?/m0/s1 |
| InChIKey | BQJSTHFXSBHZGO-FRTZAEHASA-N |
| XLogP | 2.36 |
| TPSA | 314.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.59 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|