C19H29N6O7P — CID 511244
[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 2-cyanoethyl hexyl phosphate (PubChem CID 511244) has the molecular formula C19H29N6O7P and a molecular weight of 484.45 g/mol. Its IUPAC name is [(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 2-cyanoethyl hexyl phosphate.
| Compound Name | [(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 2-cyanoethyl hexyl phosphate |
|---|---|
| PubChem CID | 511244 |
| Molecular Formula | C19H29N6O7P |
| Molecular Weight | 484.45 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | [(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 2-cyanoethyl hexyl phosphate |
| SMILES | CCCCCCOP(=O)(OCCC#N)OC[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)C[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C19H29N6O7P/c1-3-4-5-6-9-29-33(28,30-10-7-8-20)31-13-16-15(23-24-21)11-17(32-16)25-12-14(2)18(26)22-19(25)27/h12,15-17H,3-7,9-11,13H2,1-2H3,(H,22,26,27)/t15-,16+,17+,33?/m0/s1 |
| InChIKey | GFHRNRPDKSADDV-YZVQADEVSA-N |
| XLogP | 3.46 |
| TPSA | 181.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|