C11H15N6O7P — CID 11703486
[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-carbamoylphosphinic acid (PubChem CID 11703486) has the molecular formula C11H15N6O7P and a molecular weight of 374.25 g/mol. Its IUPAC name is [(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-carbamoylphosphinic acid.
| Compound Name | [(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-carbamoylphosphinic acid |
|---|---|
| PubChem CID | 11703486 |
| Molecular Formula | C11H15N6O7P |
| Molecular Weight | 374.25 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | [(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-carbamoylphosphinic acid |
| SMILES | Cc1cn([C@H]2C[C@H](N=[N+]=[N-])[C@@H](COP(=O)(O)C(N)=O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H15N6O7P/c1-5-3-17(11(20)14-9(5)18)8-2-6(15-16-13)7(24-8)4-23-25(21,22)10(12)19/h3,6-8H,2,4H2,1H3,(H2,12,19)(H,21,22)(H,14,18,20)/t6-,7+,8+/m0/s1 |
| InChIKey | YFAORDJHSLXZRZ-XLPZGREQSA-N |
| XLogP | 0.09 |
| TPSA | 202.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.25 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|