C14H21N6O7PS — CID 11812375
methyl (2S)-2-[[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphinothioyl]amino]propanoate (PubChem CID 11812375) has the molecular formula C14H21N6O7PS and a molecular weight of 448.40 g/mol. Its IUPAC name is methyl (2S)-2-[[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphinothioyl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 11812375 |
| Molecular Formula | C14H21N6O7PS |
| Molecular Weight | 448.40 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | methyl (2S)-2-[[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphinothioyl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NP(O)(=S)OC[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)C[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C14H21N6O7PS/c1-7-5-20(14(23)16-12(7)21)11-4-9(17-19-15)10(27-11)6-26-28(24,29)18-8(2)13(22)25-3/h5,8-11H,4,6H2,1-3H3,(H,16,21,23)(H2,18,24,29)/t8-,9-,10+,11+,28?/m0/s1 |
| InChIKey | QOSJGHYJMUCETG-RUOZZZGMSA-N |
| XLogP | 0.20 |
| TPSA | 180.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.40 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|