C17H28N7O7P — CID 10528463
[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-N-[(2S)-4-methyl-1-(methylamino)-1-oxopentan-2-yl]phosphonamidic acid (PubChem CID 10528463) has the molecular formula C17H28N7O7P and a molecular weight of 473.43 g/mol. Its IUPAC name is [(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-N-[(2S)-4-methyl-1-(methylamino)-1-oxopentan-2-yl]phosphonamidic acid.
| Compound Name | [(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-N-[(2S)-4-methyl-1-(methylamino)-1-oxopentan-2-yl]phosphonamidic acid |
|---|---|
| PubChem CID | 10528463 |
| Molecular Formula | C17H28N7O7P |
| Molecular Weight | 473.43 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | [(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-N-[(2S)-4-methyl-1-(methylamino)-1-oxopentan-2-yl]phosphonamidic acid |
| SMILES | CNC(=O)[C@H](CC(C)C)NP(=O)(O)OC[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)C[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C17H28N7O7P/c1-9(2)5-12(16(26)19-4)22-32(28,29)30-8-13-11(21-23-18)6-14(31-13)24-7-10(3)15(25)20-17(24)27/h7,9,11-14H,5-6,8H2,1-4H3,(H,19,26)(H,20,25,27)(H2,22,28,29)/t11-,12-,13+,14+/m0/s1 |
| InChIKey | KEOWGUNLAVKULJ-IGQOVBAYSA-N |
| XLogP | 0.68 |
| TPSA | 200.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.43 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|