C26H44N7O9P — CID 155273766
ethyl (2S)-2-[[[3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-[[(2S)-1-ethoxy-4-methyl-1-oxopentan-2-yl]amino]phosphoryl]amino]-4-methylpentanoate (PubChem CID 155273766) has the molecular formula C26H44N7O9P and a molecular weight of 629.65 g/mol. Its IUPAC name is ethyl (2S)-2-[[[3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-[[(2S)-1-ethoxy-4-methyl-1-oxopentan-2-yl]amino]phosphoryl]amino]-4-methylpentanoate.
| Compound Name | ethyl (2S)-2-[[[3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-[[(2S)-1-ethoxy-4-methyl-1-oxopentan-2-yl]amino]phosphoryl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 155273766 |
| Molecular Formula | C26H44N7O9P |
| Molecular Weight | 629.65 g/mol |
| Exact Mass | 629.29 |
| IUPAC Name | ethyl (2S)-2-[[[3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-[[(2S)-1-ethoxy-4-methyl-1-oxopentan-2-yl]amino]phosphoryl]amino]-4-methylpentanoate |
| SMILES | CCOC(=O)[C@H](CC(C)C)NP(=O)(N[C@@H](CC(C)C)C(=O)OCC)OCC1OC(n2cc(C)c(=O)[nH]c2=O)CC1N=[N+]=[N-] |
| InChI | InChI=1S/C26H44N7O9P/c1-8-39-24(35)19(10-15(3)4)30-43(38,31-20(11-16(5)6)25(36)40-9-2)41-14-21-18(29-32-27)12-22(42-21)33-13-17(7)23(34)28-26(33)37/h13,15-16,18-22H,8-12,14H2,1-7H3,(H,28,34,37)(H2,30,31,38)/t18?,19-,20-,21?,22?/m0/s1 |
| InChIKey | VUQXFABIYHTTRD-FHPBWKMDSA-N |
| XLogP | 3.07 |
| TPSA | 215.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.65 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|