C22H28N7O9PS — CID 11814005
methyl 2-[[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-(4-nitrophenoxy)phosphinothioyl]amino]-3-methylbutanoate (PubChem CID 11814005) has the molecular formula C22H28N7O9PS and a molecular weight of 597.55 g/mol. Its IUPAC name is methyl 2-[[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-(4-nitrophenoxy)phosphinothioyl]amino]-3-methylbutanoate.
| Compound Name | methyl 2-[[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-(4-nitrophenoxy)phosphinothioyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 11814005 |
| Molecular Formula | C22H28N7O9PS |
| Molecular Weight | 597.55 g/mol |
| Exact Mass | 597.14 |
| IUPAC Name | methyl 2-[[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-(4-nitrophenoxy)phosphinothioyl]amino]-3-methylbutanoate |
| SMILES | COC(=O)C(NP(=S)(OC[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)C[C@@H]1N=[N+]=[N-])Oc1ccc([N+](=O)[O-])cc1)C(C)C |
| InChI | InChI=1S/C22H28N7O9PS/c1-12(2)19(21(31)35-4)26-39(40,38-15-7-5-14(6-8-15)29(33)34)36-11-17-16(25-27-23)9-18(37-17)28-10-13(3)20(30)24-22(28)32/h5-8,10,12,16-19H,9,11H2,1-4H3,(H,26,40)(H,24,30,32)/t16-,17+,18+,19?,39?/m0/s1 |
| InChIKey | IYIOZTVFRVIBAG-YIAMRRMHSA-N |
| XLogP | 2.83 |
| TPSA | 212.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.55 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|