C26H29N6O8P — CID 5479428
benzyl (2S)-2-[[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 5479428) has the molecular formula C26H29N6O8P and a molecular weight of 584.53 g/mol. Its IUPAC name is benzyl (2S)-2-[[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | benzyl (2S)-2-[[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 5479428 |
| Molecular Formula | C26H29N6O8P |
| Molecular Weight | 584.53 g/mol |
| Exact Mass | 584.18 |
| IUPAC Name | benzyl (2S)-2-[[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | Cc1cn([C@H]2C[C@H](N=[N+]=[N-])[C@@H](COP(=O)(N[C@@H](C)C(=O)OCc3ccccc3)Oc3ccccc3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C26H29N6O8P/c1-17-14-32(26(35)28-24(17)33)23-13-21(29-31-27)22(39-23)16-38-41(36,40-20-11-7-4-8-12-20)30-18(2)25(34)37-15-19-9-5-3-6-10-19/h3-12,14,18,21-23H,13,15-16H2,1-2H3,(H,30,36)(H,28,33,35)/t18-,21-,22+,23+,41?/m0/s1 |
| InChIKey | FFOPZZHUJNUOSA-VPBKFYLYSA-N |
| XLogP | 3.74 |
| TPSA | 186.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.53 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|