C17H19N5O6P+ — CID 11742911
[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-oxo-phenylmethoxyphosphanium (PubChem CID 11742911) has the molecular formula C17H19N5O6P+ and a molecular weight of 420.34 g/mol. Its IUPAC name is [(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-oxo-phenylmethoxyphosphanium.
| Compound Name | [(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-oxo-phenylmethoxyphosphanium |
|---|---|
| PubChem CID | 11742911 |
| Molecular Formula | C17H19N5O6P+ |
| Molecular Weight | 420.34 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | [(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-oxo-phenylmethoxyphosphanium |
| SMILES | Cc1cn([C@H]2C[C@H](N=[N+]=[N-])[C@@H](CO[P+](=O)OCc3ccccc3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H18N5O6P/c1-11-8-22(17(24)19-16(11)23)15-7-13(20-21-18)14(28-15)10-27-29(25)26-9-12-5-3-2-4-6-12/h2-6,8,13-15H,7,9-10H2,1H3/p+1/t13-,14+,15+/m0/s1 |
| InChIKey | YVKXBRKOXQPNTK-RRFJBIMHSA-O |
| XLogP | 2.70 |
| TPSA | 148.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|