C22H24N7O4P — CID 25268309
1-[(2R,4S,5S)-4-azido-5-(dianilinophosphanyloxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 25268309) has the molecular formula C22H24N7O4P and a molecular weight of 481.45 g/mol. Its IUPAC name is 1-[(2R,4S,5S)-4-azido-5-(dianilinophosphanyloxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5S)-4-azido-5-(dianilinophosphanyloxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 25268309 |
| Molecular Formula | C22H24N7O4P |
| Molecular Weight | 481.45 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | 1-[(2R,4S,5S)-4-azido-5-(dianilinophosphanyloxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2C[C@H](N=[N+]=[N-])[C@@H](COP(Nc3ccccc3)Nc3ccccc3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C22H24N7O4P/c1-15-13-29(22(31)24-21(15)30)20-12-18(25-28-23)19(33-20)14-32-34(26-16-8-4-2-5-9-16)27-17-10-6-3-7-11-17/h2-11,13,18-20,26-27H,12,14H2,1H3,(H,24,30,31)/t18-,19+,20+/m0/s1 |
| InChIKey | MBJFHEFZFNPEIR-XUVXKRRUSA-N |
| XLogP | 4.28 |
| TPSA | 146.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.45 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|