C20H23N6O8P — CID 71431485
CID 71431485 (PubChem CID 71431485) has the molecular formula C20H23N6O8P and a molecular weight of 506.41 g/mol.
| Compound Name | CID 71431485 |
|---|---|
| PubChem CID | 71431485 |
| Molecular Formula | C20H23N6O8P |
| Molecular Weight | 506.41 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | — |
| SMILES | COC(=O)[C@H](Cc1ccccc1)/N=[P+](\[O-])OOCC1OC(n2cc(C)c(=O)[nH]c2=O)CC1N=[N+]=[N-] |
| InChI | InChI=1S/C20H23N6O8P/c1-12-10-26(20(29)22-18(12)27)17-9-14(23-25-21)16(33-17)11-32-34-35(30)24-15(19(28)31-2)8-13-6-4-3-5-7-13/h3-7,10,14-17H,8-9,11H2,1-2H3,(H,22,27,29)/t14?,15-,16?,17?/m0/s1 |
| InChIKey | KOPGCCRUZQROJS-YSURMTKTSA-N |
| XLogP | 1.40 |
| TPSA | 193.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.41 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|