C21H22FN4O9P — CID 71431589
CID 71431589 (PubChem CID 71431589) has the molecular formula C21H22FN4O9P and a molecular weight of 524.40 g/mol.
| Compound Name | CID 71431589 |
|---|---|
| PubChem CID | 71431589 |
| Molecular Formula | C21H22FN4O9P |
| Molecular Weight | 524.40 g/mol |
| Exact Mass | 524.11 |
| IUPAC Name | — |
| SMILES | COC(=O)C(Cc1c[nH]c2ccccc12)/N=[P+](\[O-])OOCC1OC(n2cc(F)c(=O)[nH]c2=O)CC1O |
| InChI | InChI=1S/C21H22FN4O9P/c1-32-20(29)15(6-11-8-23-14-5-3-2-4-12(11)14)25-36(31)35-33-10-17-16(27)7-18(34-17)26-9-13(22)19(28)24-21(26)30/h2-5,8-9,15-18,23,27H,6-7,10H2,1H3,(H,24,28,30) |
| InChIKey | YVLNGLIFBBLONT-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 180.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.40 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|