C9H11FN3O8P — CID 90191218
[5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-N-oxophosphonamidic acid (PubChem CID 90191218) has the molecular formula C9H11FN3O8P and a molecular weight of 339.17 g/mol. Its IUPAC name is [5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-N-oxophosphonamidic acid.
| Compound Name | [5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-N-oxophosphonamidic acid |
|---|---|
| PubChem CID | 90191218 |
| Molecular Formula | C9H11FN3O8P |
| Molecular Weight | 339.17 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | [5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-N-oxophosphonamidic acid |
| SMILES | O=NP(=O)(O)OCC1OC(n2cc(F)c(=O)[nH]c2=O)CC1O |
| InChI | InChI=1S/C9H11FN3O8P/c10-4-2-13(9(16)11-8(4)15)7-1-5(14)6(21-7)3-20-22(18,19)12-17/h2,5-7,14H,1,3H2,(H,18,19)(H,11,15,16) |
| InChIKey | PLMGYAXKWWXCLV-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 160.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.17 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|