C9H14FN2O9P — CID 66863184
5-fluoro-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;phosphoric acid (PubChem CID 66863184) has the molecular formula C9H14FN2O9P and a molecular weight of 344.19 g/mol. Its IUPAC name is 5-fluoro-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;phosphoric acid.
| Compound Name | 5-fluoro-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;phosphoric acid |
|---|---|
| PubChem CID | 66863184 |
| Molecular Formula | C9H14FN2O9P |
| Molecular Weight | 344.19 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 5-fluoro-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;phosphoric acid |
| SMILES | O=P(O)(O)O.O=c1[nH]c(=O)n([C@H]2C[C@H](O)[C@@H](CO)O2)cc1F |
| InChI | InChI=1S/C9H11FN2O5.H3O4P/c10-4-2-12(9(16)11-8(4)15)7-1-5(14)6(3-13)17-7;1-5(2,3)4/h2,5-7,13-14H,1,3H2,(H,11,15,16);(H3,1,2,3,4)/t5-,6+,7+;/m0./s1 |
| InChIKey | DYEXONVDIJDFRC-VWZUFWLJSA-N |
| XLogP | -2.61 |
| TPSA | 182.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.19 |
| LogP ≤ 5 | -2.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|