C18H20F4N4O8 — CID 139053601
5-fluoro-1-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 139053601) has the molecular formula C18H20F4N4O8 and a molecular weight of 496.37 g/mol. Its IUPAC name is 5-fluoro-1-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-fluoro-1-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 139053601 |
| Molecular Formula | C18H20F4N4O8 |
| Molecular Weight | 496.37 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | 5-fluoro-1-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n([C@H]2C[C@H](F)[C@@H](CO)O2)cc1F.O=c1[nH]c(=O)n([C@H]2C[C@H](F)[C@@H](CO)O2)cc1F |
| InChI | InChI=1S/2C9H10F2N2O4/c2*10-4-1-7(17-6(4)3-14)13-2-5(11)8(15)12-9(13)16/h2*2,4,6-7,14H,1,3H2,(H,12,15,16)/t2*4-,6+,7+/m00/s1 |
| InChIKey | RQQZBGYZEXQYMP-ROKGEBTNSA-N |
| XLogP | -1.41 |
| TPSA | 168.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.37 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |