C11H11FI2N2O4 — CID 91462837
5-(1,2-diiodoethenyl)-1-[4-fluoro-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 91462837) has the molecular formula C11H11FI2N2O4 and a molecular weight of 508.03 g/mol. Its IUPAC name is 5-(1,2-diiodoethenyl)-1-[4-fluoro-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-(1,2-diiodoethenyl)-1-[4-fluoro-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 91462837 |
| Molecular Formula | C11H11FI2N2O4 |
| Molecular Weight | 508.03 g/mol |
| Exact Mass | 507.88 |
| IUPAC Name | 5-(1,2-diiodoethenyl)-1-[4-fluoro-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(C2CC(F)C(CO)O2)cc1C(I)=CI |
| InChI | InChI=1S/C11H11FI2N2O4/c12-6-1-9(20-8(6)4-17)16-3-5(7(14)2-13)10(18)15-11(16)19/h2-3,6,8-9,17H,1,4H2,(H,15,18,19) |
| InChIKey | JSMDYBKXGQSQFR-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.03 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|