C9H10F2N2O3S — CID 11747467
5-fluoro-1-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-4-sulfanylidenepyrimidin-2-one (PubChem CID 11747467) has the molecular formula C9H10F2N2O3S and a molecular weight of 264.25 g/mol. Its IUPAC name is 5-fluoro-1-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-4-sulfanylidenepyrimidin-2-one.
| Compound Name | 5-fluoro-1-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-4-sulfanylidenepyrimidin-2-one |
|---|---|
| PubChem CID | 11747467 |
| Molecular Formula | C9H10F2N2O3S |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 5-fluoro-1-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-4-sulfanylidenepyrimidin-2-one |
| SMILES | O=c1[nH]c(=S)c(F)cn1[C@H]1C[C@H](F)[C@@H](CO)O1 |
| InChI | InChI=1S/C9H10F2N2O3S/c10-4-1-7(16-6(4)3-14)13-2-5(11)8(17)12-9(13)15/h2,4,6-7,14H,1,3H2,(H,12,15,17)/t4-,6+,7+/m0/s1 |
| InChIKey | XZVYRLWGAWWSIP-UBKIQSJTSA-N |
| XLogP | 0.66 |
| TPSA | 67.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|