C10H12FIN2O3 — CID 174066539
1-[(4S,5S)-4-fluoro-5-(iodomethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 174066539) has the molecular formula C10H12FIN2O3 and a molecular weight of 354.12 g/mol. Its IUPAC name is 1-[(4S,5S)-4-fluoro-5-(iodomethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(4S,5S)-4-fluoro-5-(iodomethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 174066539 |
| Molecular Formula | C10H12FIN2O3 |
| Molecular Weight | 354.12 g/mol |
| Exact Mass | 353.99 |
| IUPAC Name | 1-[(4S,5S)-4-fluoro-5-(iodomethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn(C2C[C@H](F)[C@@H](CI)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H12FIN2O3/c1-5-4-14(10(16)13-9(5)15)8-2-6(11)7(3-12)17-8/h4,6-8H,2-3H2,1H3,(H,13,15,16)/t6-,7+,8?/m0/s1 |
| InChIKey | NFVROOJBDFPBRE-KJFJCRTCSA-N |
| XLogP | 0.91 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.12 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|