C10H13FN2O3S — CID 90996877
1-[(2R,4S)-4-fluoro-5-(sulfanylmethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 90996877) has the molecular formula C10H13FN2O3S and a molecular weight of 260.29 g/mol. Its IUPAC name is 1-[(2R,4S)-4-fluoro-5-(sulfanylmethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S)-4-fluoro-5-(sulfanylmethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 90996877 |
| Molecular Formula | C10H13FN2O3S |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 1-[(2R,4S)-4-fluoro-5-(sulfanylmethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2C[C@H](F)C(CS)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H13FN2O3S/c1-5-3-13(10(15)12-9(5)14)8-2-6(11)7(4-17)16-8/h3,6-8,17H,2,4H2,1H3,(H,12,14,15)/t6-,7?,8+/m0/s1 |
| InChIKey | FNVSMBDMHKBNIL-YPVSKDHRSA-N |
| XLogP | 0.40 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|