C10H14AcN2O4S — CID 59948488
actinium;1-[(5S)-4-hydroxy-5-(sulfanylmethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 59948488) has the molecular formula C10H14AcN2O4S and a molecular weight of 485.30 g/mol. Its IUPAC name is actinium;1-[(5S)-4-hydroxy-5-(sulfanylmethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | actinium;1-[(5S)-4-hydroxy-5-(sulfanylmethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 59948488 |
| Molecular Formula | C10H14AcN2O4S |
| Molecular Weight | 485.30 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | actinium;1-[(5S)-4-hydroxy-5-(sulfanylmethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn(C2CC(O)[C@@H](CS)O2)c(=O)[nH]c1=O.[Ac] |
| InChI | InChI=1S/C10H14N2O4S.Ac/c1-5-3-12(10(15)11-9(5)14)8-2-6(13)7(4-17)16-8;/h3,6-8,13,17H,2,4H2,1H3,(H,11,14,15);/t6?,7-,8?;/m1./s1 |
| InChIKey | WLCYBQASEMSHHK-PSQCCDSISA-N |
| XLogP | -0.58 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.30 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|