C11H15FN2O6S — CID 14828088
[3-fluoro-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl methanesulfonate (PubChem CID 14828088) has the molecular formula C11H15FN2O6S and a molecular weight of 322.31 g/mol. Its IUPAC name is [3-fluoro-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl methanesulfonate.
| Compound Name | [3-fluoro-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 14828088 |
| Molecular Formula | C11H15FN2O6S |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | [3-fluoro-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl methanesulfonate |
| SMILES | Cc1cn(C2CC(F)C(COS(C)(=O)=O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H15FN2O6S/c1-6-4-14(11(16)13-10(6)15)9-3-7(12)8(20-9)5-19-21(2,17)18/h4,7-9H,3,5H2,1-2H3,(H,13,15,16) |
| InChIKey | KIEUYYVPJIIRHO-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|