C12H16FN2O6P — CID 5274137
ethenyl-[[(2R,3S,5R)-3-fluoro-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphinic acid (PubChem CID 5274137) has the molecular formula C12H16FN2O6P and a molecular weight of 334.24 g/mol. Its IUPAC name is ethenyl-[[(2R,3S,5R)-3-fluoro-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphinic acid.
| Compound Name | ethenyl-[[(2R,3S,5R)-3-fluoro-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphinic acid |
|---|---|
| PubChem CID | 5274137 |
| Molecular Formula | C12H16FN2O6P |
| Molecular Weight | 334.24 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | ethenyl-[[(2R,3S,5R)-3-fluoro-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphinic acid |
| SMILES | C=CP(=O)(O)OC[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)C[C@@H]1F |
| InChI | InChI=1S/C12H16FN2O6P/c1-3-22(18,19)20-6-9-8(13)4-10(21-9)15-5-7(2)11(16)14-12(15)17/h3,5,8-10H,1,4,6H2,2H3,(H,18,19)(H,14,16,17)/t8-,9+,10+/m0/s1 |
| InChIKey | TZBJIJPCMYZSHO-IVZWLZJFSA-N |
| XLogP | 0.82 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.24 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|