C13H19N2O8P — CID 122419534
[(2R,3R,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-prop-2-enoxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 122419534) has the molecular formula C13H19N2O8P and a molecular weight of 362.28 g/mol. Its IUPAC name is [(2R,3R,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-prop-2-enoxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3R,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-prop-2-enoxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 122419534 |
| Molecular Formula | C13H19N2O8P |
| Molecular Weight | 362.28 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | [(2R,3R,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-prop-2-enoxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | C=CCO[C@@H]1C[C@H](n2cc(C)c(=O)[nH]c2=O)O[C@@H]1COP(=O)(O)O |
| InChI | InChI=1S/C13H19N2O8P/c1-3-4-21-9-5-11(23-10(9)7-22-24(18,19)20)15-6-8(2)12(16)14-13(15)17/h3,6,9-11H,1,4-5,7H2,2H3,(H,14,16,17)(H2,18,19,20)/t9-,10-,11-/m1/s1 |
| InChIKey | BQFGGKPEQBXDQD-GMTAPVOTSA-N |
| XLogP | -0.19 |
| TPSA | 140.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.28 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|