C14H21N2O8P — CID 154975553
[(3R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-(prop-2-enoxymethoxy)oxolan-2-yl]methyl dihydrogen phosphite (PubChem CID 154975553) has the molecular formula C14H21N2O8P and a molecular weight of 376.30 g/mol. Its IUPAC name is [(3R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-(prop-2-enoxymethoxy)oxolan-2-yl]methyl dihydrogen phosphite.
| Compound Name | [(3R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-(prop-2-enoxymethoxy)oxolan-2-yl]methyl dihydrogen phosphite |
|---|---|
| PubChem CID | 154975553 |
| Molecular Formula | C14H21N2O8P |
| Molecular Weight | 376.30 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | [(3R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-(prop-2-enoxymethoxy)oxolan-2-yl]methyl dihydrogen phosphite |
| SMILES | C=CCOCO[C@@H]1CC(n2cc(C)c(=O)[nH]c2=O)OC1COP(O)O |
| InChI | InChI=1S/C14H21N2O8P/c1-3-4-21-8-22-10-5-12(24-11(10)7-23-25(19)20)16-6-9(2)13(17)15-14(16)18/h3,6,10-12,19-20H,1,4-5,7-8H2,2H3,(H,15,17,18)/t10-,11?,12?/m1/s1 |
| InChIKey | VASRMSZBMXLCFX-VOMCLLRMSA-N |
| XLogP | -0.09 |
| TPSA | 132.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.30 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|