C16H30N2O5Si2 — CID 90912443
5-methyl-1-[(2R,4S,5R)-4-trimethylsilyloxy-5-(trimethylsilyloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 90912443) has the molecular formula C16H30N2O5Si2 and a molecular weight of 386.60 g/mol. Its IUPAC name is 5-methyl-1-[(2R,4S,5R)-4-trimethylsilyloxy-5-(trimethylsilyloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-methyl-1-[(2R,4S,5R)-4-trimethylsilyloxy-5-(trimethylsilyloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 90912443 |
| Molecular Formula | C16H30N2O5Si2 |
| Molecular Weight | 386.60 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 5-methyl-1-[(2R,4S,5R)-4-trimethylsilyloxy-5-(trimethylsilyloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2C[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H30N2O5Si2/c1-11-9-18(16(20)17-15(11)19)14-8-12(23-25(5,6)7)13(22-14)10-21-24(2,3)4/h9,12-14H,8,10H2,1-7H3,(H,17,19,20)/t12-,13+,14+/m0/s1 |
| InChIKey | IIORRTMASMPHAF-BFHYXJOUSA-N |
| XLogP | 2.20 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.60 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|