C22H45N2O7PSi3 — CID 11757634
[(2R,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl bis(trimethylsilyl) phosphite (PubChem CID 11757634) has the molecular formula C22H45N2O7PSi3 and a molecular weight of 564.84 g/mol. Its IUPAC name is [(2R,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl bis(trimethylsilyl) phosphite.
| Compound Name | [(2R,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl bis(trimethylsilyl) phosphite |
|---|---|
| PubChem CID | 11757634 |
| Molecular Formula | C22H45N2O7PSi3 |
| Molecular Weight | 564.84 g/mol |
| Exact Mass | 564.23 |
| IUPAC Name | [(2R,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl bis(trimethylsilyl) phosphite |
| SMILES | Cc1cn([C@H]2C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(O[Si](C)(C)C)O[Si](C)(C)C)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C22H45N2O7PSi3/c1-16-14-24(21(26)23-20(16)25)19-13-17(29-35(11,12)22(2,3)4)18(28-19)15-27-32(30-33(5,6)7)31-34(8,9)10/h14,17-19H,13,15H2,1-12H3,(H,23,25,26)/t17-,18+,19+/m0/s1 |
| InChIKey | MHCLFTKBSARUMZ-IPMKNSEASA-N |
| XLogP | 5.47 |
| TPSA | 101.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.84 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|