C30H39N2O6PS2Si — CID 134885483
1-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[9H-fluoren-9-ylmethoxy(sulfanyl)phosphinothioyl]oxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 134885483) has the molecular formula C30H39N2O6PS2Si and a molecular weight of 646.84 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[9H-fluoren-9-ylmethoxy(sulfanyl)phosphinothioyl]oxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[9H-fluoren-9-ylmethoxy(sulfanyl)phosphinothioyl]oxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 134885483 |
| Molecular Formula | C30H39N2O6PS2Si |
| Molecular Weight | 646.84 g/mol |
| Exact Mass | 646.18 |
| IUPAC Name | 1-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[9H-fluoren-9-ylmethoxy(sulfanyl)phosphinothioyl]oxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(=S)(S)OCC3c4ccccc4-c4ccccc43)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C30H39N2O6PS2Si/c1-19-16-32(29(34)31-28(19)33)27-15-25(38-42(5,6)30(2,3)4)26(37-27)18-36-39(40,41)35-17-24-22-13-9-7-11-20(22)21-12-8-10-14-23(21)24/h7-14,16,24-27H,15,17-18H2,1-6H3,(H,40,41)(H,31,33,34)/t25-,26+,27+/m0/s1 |
| InChIKey | BTNNWCUSWLZGIH-OYUWMTPXSA-N |
| XLogP | 6.52 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.84 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|