C18H30N2O6Si — CID 57251904
3-[(2R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]propanoic acid (PubChem CID 57251904) has the molecular formula C18H30N2O6Si and a molecular weight of 398.53 g/mol. Its IUPAC name is 3-[(2R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]propanoic acid.
| Compound Name | 3-[(2R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]propanoic acid |
|---|---|
| PubChem CID | 57251904 |
| Molecular Formula | C18H30N2O6Si |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 3-[(2R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]propanoic acid |
| SMILES | Cc1cn([C@H]2CC(O[Si](C)(C)C(C)(C)C)[C@@H](CCC(=O)O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H30N2O6Si/c1-11-10-20(17(24)19-16(11)23)14-9-13(12(25-14)7-8-15(21)22)26-27(5,6)18(2,3)4/h10,12-14H,7-9H2,1-6H3,(H,21,22)(H,19,23,24)/t12-,13?,14-/m1/s1 |
| InChIKey | ODDHFEMQALQDQR-WYAMFQBQSA-N |
| XLogP | 2.39 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|