C18H31N3O6Si — CID 158180539
(2S,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-N-methoxy-N-methyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolane-2-carboxamide (PubChem CID 158180539) has the molecular formula C18H31N3O6Si and a molecular weight of 413.55 g/mol. Its IUPAC name is (2S,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-N-methoxy-N-methyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolane-2-carboxamide.
| Compound Name | (2S,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-N-methoxy-N-methyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 158180539 |
| Molecular Formula | C18H31N3O6Si |
| Molecular Weight | 413.55 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | (2S,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-N-methoxy-N-methyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolane-2-carboxamide |
| SMILES | CON(C)C(=O)[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H31N3O6Si/c1-11-10-21(17(24)19-15(11)22)13-9-12(27-28(7,8)18(2,3)4)14(26-13)16(23)20(5)25-6/h10,12-14H,9H2,1-8H3,(H,19,22,24)/t12-,13-,14+/m1/s1 |
| InChIKey | FPGJDKBJLGIXMP-MCIONIFRSA-N |
| XLogP | 1.54 |
| TPSA | 102.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.55 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|