C16H26N2O4Si — CID 11313759
1-[(2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-5-methylideneoxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 11313759) has the molecular formula C16H26N2O4Si and a molecular weight of 338.48 g/mol. Its IUPAC name is 1-[(2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-5-methylideneoxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-5-methylideneoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11313759 |
| Molecular Formula | C16H26N2O4Si |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 1-[(2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-5-methylideneoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | C=C1O[C@@H](n2cc(C)c(=O)[nH]c2=O)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H26N2O4Si/c1-10-9-18(15(20)17-14(10)19)13-8-12(11(2)21-13)22-23(6,7)16(3,4)5/h9,12-13H,2,8H2,1,3-7H3,(H,17,19,20)/t12-,13+/m0/s1 |
| InChIKey | ZIESHTXGCMQNHU-QWHCGFSZSA-N |
| XLogP | 2.67 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|